C25H18Br2N2O4S2 — CID 3112211
2-N,7-N-bis(4-bromophenyl)-9H-fluorene-2,7-disulfonamide (PubChem CID 3112211) has the molecular formula C25H18Br2N2O4S2 and a molecular weight of 634.37 g/mol. Its IUPAC name is 2-N,7-N-bis(4-bromophenyl)-9H-fluorene-2,7-disulfonamide.
| Compound Name | 2-N,7-N-bis(4-bromophenyl)-9H-fluorene-2,7-disulfonamide |
|---|---|
| PubChem CID | 3112211 |
| Molecular Formula | C25H18Br2N2O4S2 |
| Molecular Weight | 634.37 g/mol |
| Exact Mass | 631.91 |
| IUPAC Name | 2-N,7-N-bis(4-bromophenyl)-9H-fluorene-2,7-disulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Br)cc1)c1ccc2c(c1)Cc1cc(S(=O)(=O)Nc3ccc(Br)cc3)ccc1-2 |
| InChI | InChI=1S/C25H18Br2N2O4S2/c26-18-1-5-20(6-2-18)28-34(30,31)22-9-11-24-16(14-22)13-17-15-23(10-12-25(17)24)35(32,33)29-21-7-3-19(27)4-8-21/h1-12,14-15,28-29H,13H2 |
| InChIKey | XDXPNZFCXPFVQF-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.37 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |