C26H20N2O7S2 — CID 140937933
2-N,7-N-bis(4-hydroxyphenyl)-9-oxo-10H-anthracene-2,7-disulfonamide (PubChem CID 140937933) has the molecular formula C26H20N2O7S2 and a molecular weight of 536.59 g/mol. Its IUPAC name is 2-N,7-N-bis(4-hydroxyphenyl)-9-oxo-10H-anthracene-2,7-disulfonamide.
| Compound Name | 2-N,7-N-bis(4-hydroxyphenyl)-9-oxo-10H-anthracene-2,7-disulfonamide |
|---|---|
| PubChem CID | 140937933 |
| Molecular Formula | C26H20N2O7S2 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.07 |
| IUPAC Name | 2-N,7-N-bis(4-hydroxyphenyl)-9-oxo-10H-anthracene-2,7-disulfonamide |
| SMILES | O=C1c2cc(S(=O)(=O)Nc3ccc(O)cc3)ccc2Cc2ccc(S(=O)(=O)Nc3ccc(O)cc3)cc21 |
| InChI | InChI=1S/C26H20N2O7S2/c29-20-7-3-18(4-8-20)27-36(32,33)22-11-1-16-13-17-2-12-23(15-25(17)26(31)24(16)14-22)37(34,35)28-19-5-9-21(30)10-6-19/h1-12,14-15,27-30H,13H2 |
| InChIKey | VAAUPHGZEJKCDS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|