C14H10BrN3O4S — CID 4178720
N-(4-bromophenyl)-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 4178720) has the molecular formula C14H10BrN3O4S and a molecular weight of 396.22 g/mol. Its IUPAC name is N-(4-bromophenyl)-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | N-(4-bromophenyl)-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 4178720 |
| Molecular Formula | C14H10BrN3O4S |
| Molecular Weight | 396.22 g/mol |
| Exact Mass | 394.96 |
| IUPAC Name | N-(4-bromophenyl)-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)Nc3ccc(Br)cc3)cc2[nH]c1=O |
| InChI | InChI=1S/C14H10BrN3O4S/c15-8-1-3-9(4-2-8)18-23(21,22)10-5-6-11-12(7-10)17-14(20)13(19)16-11/h1-7,18H,(H,16,19)(H,17,20) |
| InChIKey | NESCUKRAVDFFCC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|