C16H13N3O6S — CID 15999609
methyl 4-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]benzoate (PubChem CID 15999609) has the molecular formula C16H13N3O6S and a molecular weight of 375.36 g/mol. Its IUPAC name is methyl 4-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]benzoate.
| Compound Name | methyl 4-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 15999609 |
| Molecular Formula | C16H13N3O6S |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | methyl 4-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]benzoate |
| SMILES | COC(=O)c1ccc(NS(=O)(=O)c2ccc3[nH]c(=O)c(=O)[nH]c3c2)cc1 |
| InChI | InChI=1S/C16H13N3O6S/c1-25-16(22)9-2-4-10(5-3-9)19-26(23,24)11-6-7-12-13(8-11)18-15(21)14(20)17-12/h2-8,19H,1H3,(H,17,20)(H,18,21) |
| InChIKey | PFBQQLQWFPUNSY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 138.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|