C7H5NaO3S — CID 172838674
sodium bicyclo[4.1.0]hepta-1(6),2,4-triene-3-sulfonate (PubChem CID 172838674) has the molecular formula C7H5NaO3S and a molecular weight of 192.17 g/mol. Its IUPAC name is sodium bicyclo[4.1.0]hepta-1(6),2,4-triene-3-sulfonate.
| Compound Name | sodium bicyclo[4.1.0]hepta-1(6),2,4-triene-3-sulfonate |
|---|---|
| PubChem CID | 172838674 |
| Molecular Formula | C7H5NaO3S |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 191.99 |
| IUPAC Name | sodium bicyclo[4.1.0]hepta-1(6),2,4-triene-3-sulfonate |
| SMILES | O=S(=O)([O-])c1ccc2c(c1)C2.[Na+] |
| InChI | InChI=1S/C7H6O3S.Na/c8-11(9,10)7-2-1-5-3-6(5)4-7;/h1-2,4H,3H2,(H,8,9,10);/q;+1/p-1 |
| InChIKey | WMPYYQPZOZNGTF-UHFFFAOYSA-M |
| XLogP | -2.50 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|