C14H12O6S2 — CID 21114729
9,10-dihydroanthracene-2,6-disulfonic acid (PubChem CID 21114729) has the molecular formula C14H12O6S2 and a molecular weight of 340.38 g/mol. Its IUPAC name is 9,10-dihydroanthracene-2,6-disulfonic acid.
| Compound Name | 9,10-dihydroanthracene-2,6-disulfonic acid |
|---|---|
| PubChem CID | 21114729 |
| Molecular Formula | C14H12O6S2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 9,10-dihydroanthracene-2,6-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(c1)Cc1ccc(S(=O)(=O)O)cc1C2 |
| InChI | InChI=1S/C14H12O6S2/c15-21(16,17)13-3-1-9-5-12-8-14(22(18,19)20)4-2-10(12)6-11(9)7-13/h1-4,7-8H,5-6H2,(H,15,16,17)(H,18,19,20) |
| InChIKey | RNUMOGVAAPRXAN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|