C9H13NO4S — CID 71328506
1,2,3,4-tetrahydroquinoline-7-sulfonic acid;hydrate (PubChem CID 71328506) has the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroquinoline-7-sulfonic acid;hydrate.
| Compound Name | 1,2,3,4-tetrahydroquinoline-7-sulfonic acid;hydrate |
|---|---|
| PubChem CID | 71328506 |
| Molecular Formula | C9H13NO4S |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 1,2,3,4-tetrahydroquinoline-7-sulfonic acid;hydrate |
| SMILES | O.O=S(=O)(O)c1ccc2c(c1)NCCC2 |
| InChI | InChI=1S/C9H11NO3S.H2O/c11-14(12,13)8-4-3-7-2-1-5-10-9(7)6-8;/h3-4,6,10H,1-2,5H2,(H,11,12,13);1H2 |
| InChIKey | RQXIKHBNUVPPQL-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|