C13H14N4O3S — CID 116787348
N-(6-oxo-1H-pyridazin-3-yl)-1,2,3,4-tetrahydroquinoline-7-sulfonamide (PubChem CID 116787348) has the molecular formula C13H14N4O3S and a molecular weight of 306.35 g/mol. Its IUPAC name is N-(6-oxo-1H-pyridazin-3-yl)-1,2,3,4-tetrahydroquinoline-7-sulfonamide.
| Compound Name | N-(6-oxo-1H-pyridazin-3-yl)-1,2,3,4-tetrahydroquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 116787348 |
| Molecular Formula | C13H14N4O3S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | N-(6-oxo-1H-pyridazin-3-yl)-1,2,3,4-tetrahydroquinoline-7-sulfonamide |
| SMILES | O=c1ccc(NS(=O)(=O)c2ccc3c(c2)NCCC3)n[nH]1 |
| InChI | InChI=1S/C13H14N4O3S/c18-13-6-5-12(15-16-13)17-21(19,20)10-4-3-9-2-1-7-14-11(9)8-10/h3-6,8,14H,1-2,7H2,(H,15,17)(H,16,18) |
| InChIKey | BDYNHQMNQVNLER-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |