C11H9N3O5S — CID 116786477
3-[(6-oxo-1H-pyridazin-3-yl)sulfamoyl]benzoic acid (PubChem CID 116786477) has the molecular formula C11H9N3O5S and a molecular weight of 295.28 g/mol. Its IUPAC name is 3-[(6-oxo-1H-pyridazin-3-yl)sulfamoyl]benzoic acid.
| Compound Name | 3-[(6-oxo-1H-pyridazin-3-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 116786477 |
| Molecular Formula | C11H9N3O5S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 3-[(6-oxo-1H-pyridazin-3-yl)sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1cccc(S(=O)(=O)Nc2ccc(=O)[nH]n2)c1 |
| InChI | InChI=1S/C11H9N3O5S/c15-10-5-4-9(12-13-10)14-20(18,19)8-3-1-2-7(6-8)11(16)17/h1-6H,(H,12,14)(H,13,15)(H,16,17) |
| InChIKey | DDQHBLPSXFHIHT-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 129.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |