C12H12N4O3S2 — CID 106920403
2-methyl-4-[(6-oxo-1H-pyridazin-3-yl)sulfamoyl]benzenecarbothioamide (PubChem CID 106920403) has the molecular formula C12H12N4O3S2 and a molecular weight of 324.39 g/mol. Its IUPAC name is 2-methyl-4-[(6-oxo-1H-pyridazin-3-yl)sulfamoyl]benzenecarbothioamide.
| Compound Name | 2-methyl-4-[(6-oxo-1H-pyridazin-3-yl)sulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 106920403 |
| Molecular Formula | C12H12N4O3S2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 2-methyl-4-[(6-oxo-1H-pyridazin-3-yl)sulfamoyl]benzenecarbothioamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccc(=O)[nH]n2)ccc1C(N)=S |
| InChI | InChI=1S/C12H12N4O3S2/c1-7-6-8(2-3-9(7)12(13)20)21(18,19)16-10-4-5-11(17)15-14-10/h2-6H,1H3,(H2,13,20)(H,14,16)(H,15,17) |
| InChIKey | KCQFGZZHUUZINU-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|