C9H9ClN6O3S — CID 116787309
5-chloro-6-hydrazinyl-N-(6-oxo-1H-pyridazin-3-yl)pyridine-3-sulfonamide (PubChem CID 116787309) has the molecular formula C9H9ClN6O3S and a molecular weight of 316.73 g/mol. Its IUPAC name is 5-chloro-6-hydrazinyl-N-(6-oxo-1H-pyridazin-3-yl)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-hydrazinyl-N-(6-oxo-1H-pyridazin-3-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 116787309 |
| Molecular Formula | C9H9ClN6O3S |
| Molecular Weight | 316.73 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 5-chloro-6-hydrazinyl-N-(6-oxo-1H-pyridazin-3-yl)pyridine-3-sulfonamide |
| SMILES | NNc1ncc(S(=O)(=O)Nc2ccc(=O)[nH]n2)cc1Cl |
| InChI | InChI=1S/C9H9ClN6O3S/c10-6-3-5(4-12-9(6)13-11)20(18,19)16-7-1-2-8(17)15-14-7/h1-4H,11H2,(H,12,13)(H,14,16)(H,15,17) |
| InChIKey | WBEOUXUBOUOUIP-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 142.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.73 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|