C11H9Br2ClN4O2S — CID 64609135
5-chloro-N-(2,4-dibromophenyl)-6-hydrazinylpyridine-3-sulfonamide (PubChem CID 64609135) has the molecular formula C11H9Br2ClN4O2S and a molecular weight of 456.55 g/mol. Its IUPAC name is 5-chloro-N-(2,4-dibromophenyl)-6-hydrazinylpyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-(2,4-dibromophenyl)-6-hydrazinylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64609135 |
| Molecular Formula | C11H9Br2ClN4O2S |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 453.85 |
| IUPAC Name | 5-chloro-N-(2,4-dibromophenyl)-6-hydrazinylpyridine-3-sulfonamide |
| SMILES | NNc1ncc(S(=O)(=O)Nc2ccc(Br)cc2Br)cc1Cl |
| InChI | InChI=1S/C11H9Br2ClN4O2S/c12-6-1-2-10(8(13)3-6)18-21(19,20)7-4-9(14)11(17-15)16-5-7/h1-5,18H,15H2,(H,16,17) |
| InChIKey | UJGBJGPCUFAFFP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|