C12H13ClN4O2S2 — CID 64607396
5-chloro-6-hydrazinyl-N-(4-methylsulfanylphenyl)pyridine-3-sulfonamide (PubChem CID 64607396) has the molecular formula C12H13ClN4O2S2 and a molecular weight of 344.85 g/mol. Its IUPAC name is 5-chloro-6-hydrazinyl-N-(4-methylsulfanylphenyl)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-hydrazinyl-N-(4-methylsulfanylphenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64607396 |
| Molecular Formula | C12H13ClN4O2S2 |
| Molecular Weight | 344.85 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 5-chloro-6-hydrazinyl-N-(4-methylsulfanylphenyl)pyridine-3-sulfonamide |
| SMILES | CSc1ccc(NS(=O)(=O)c2cnc(NN)c(Cl)c2)cc1 |
| InChI | InChI=1S/C12H13ClN4O2S2/c1-20-9-4-2-8(3-5-9)17-21(18,19)10-6-11(13)12(16-14)15-7-10/h2-7,17H,14H2,1H3,(H,15,16) |
| InChIKey | UUXVMKQXOXYZHE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.85 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|