C11H12ClN5O3S — CID 64606447
5-chloro-6-hydrazinyl-N-(6-methoxy-3-pyridinyl)pyridine-3-sulfonamide (PubChem CID 64606447) has the molecular formula C11H12ClN5O3S and a molecular weight of 329.77 g/mol. Its IUPAC name is 5-chloro-6-hydrazinyl-N-(6-methoxy-3-pyridinyl)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-hydrazinyl-N-(6-methoxy-3-pyridinyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64606447 |
| Molecular Formula | C11H12ClN5O3S |
| Molecular Weight | 329.77 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 5-chloro-6-hydrazinyl-N-(6-methoxy-3-pyridinyl)pyridine-3-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cnc(NN)c(Cl)c2)cn1 |
| InChI | InChI=1S/C11H12ClN5O3S/c1-20-10-3-2-7(5-14-10)17-21(18,19)8-4-9(12)11(16-13)15-6-8/h2-6,17H,13H2,1H3,(H,15,16) |
| InChIKey | FRBYCPDINOQDTO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.77 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|