C9H9ClN6O2S — CID 64608544
5-chloro-6-hydrazinyl-N-pyrimidin-2-ylpyridine-3-sulfonamide (PubChem CID 64608544) has the molecular formula C9H9ClN6O2S and a molecular weight of 300.73 g/mol. Its IUPAC name is 5-chloro-6-hydrazinyl-N-pyrimidin-2-ylpyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-hydrazinyl-N-pyrimidin-2-ylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64608544 |
| Molecular Formula | C9H9ClN6O2S |
| Molecular Weight | 300.73 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 5-chloro-6-hydrazinyl-N-pyrimidin-2-ylpyridine-3-sulfonamide |
| SMILES | NNc1ncc(S(=O)(=O)Nc2ncccn2)cc1Cl |
| InChI | InChI=1S/C9H9ClN6O2S/c10-7-4-6(5-14-8(7)15-11)19(17,18)16-9-12-2-1-3-13-9/h1-5H,11H2,(H,14,15)(H,12,13,16) |
| InChIKey | VGDNIXPXFYNVOL-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.73 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|