C16H17N3O4S — CID 130406117
2-hydroxy-5-(1,2,3,4-tetrahydroquinolin-7-ylsulfamoyl)benzamide (PubChem CID 130406117) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is 2-hydroxy-5-(1,2,3,4-tetrahydroquinolin-7-ylsulfamoyl)benzamide.
| Compound Name | 2-hydroxy-5-(1,2,3,4-tetrahydroquinolin-7-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 130406117 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-hydroxy-5-(1,2,3,4-tetrahydroquinolin-7-ylsulfamoyl)benzamide |
| SMILES | NC(=O)c1cc(S(=O)(=O)Nc2ccc3c(c2)NCCC3)ccc1O |
| InChI | InChI=1S/C16H17N3O4S/c17-16(21)13-9-12(5-6-15(13)20)24(22,23)19-11-4-3-10-2-1-7-18-14(10)8-11/h3-6,8-9,18-20H,1-2,7H2,(H2,17,21) |
| InChIKey | RJHRJEQGAXBHLA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |