C15H15ClN2O2S — CID 63928946
2-chloro-N-(1,2,3,4-tetrahydroquinolin-7-yl)benzenesulfonamide (PubChem CID 63928946) has the molecular formula C15H15ClN2O2S and a molecular weight of 322.82 g/mol. Its IUPAC name is 2-chloro-N-(1,2,3,4-tetrahydroquinolin-7-yl)benzenesulfonamide.
| Compound Name | 2-chloro-N-(1,2,3,4-tetrahydroquinolin-7-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 63928946 |
| Molecular Formula | C15H15ClN2O2S |
| Molecular Weight | 322.82 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 2-chloro-N-(1,2,3,4-tetrahydroquinolin-7-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(c1)NCCC2)c1ccccc1Cl |
| InChI | InChI=1S/C15H15ClN2O2S/c16-13-5-1-2-6-15(13)21(19,20)18-12-8-7-11-4-3-9-17-14(11)10-12/h1-2,5-8,10,17-18H,3-4,9H2 |
| InChIKey | PCBNATGTTANCMG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.82 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |