C12H12ClN3O3S — CID 116787510
4-(2-chloroethyl)-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide (PubChem CID 116787510) has the molecular formula C12H12ClN3O3S and a molecular weight of 313.77 g/mol. Its IUPAC name is 4-(2-chloroethyl)-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide.
| Compound Name | 4-(2-chloroethyl)-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 116787510 |
| Molecular Formula | C12H12ClN3O3S |
| Molecular Weight | 313.77 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 4-(2-chloroethyl)-N-(6-oxo-1H-pyridazin-3-yl)benzenesulfonamide |
| SMILES | O=c1ccc(NS(=O)(=O)c2ccc(CCCl)cc2)n[nH]1 |
| InChI | InChI=1S/C12H12ClN3O3S/c13-8-7-9-1-3-10(4-2-9)20(18,19)16-11-5-6-12(17)15-14-11/h1-6H,7-8H2,(H,14,16)(H,15,17) |
| InChIKey | LVERYFRTDPFLAE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.77 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|