C10H12N4O3S2 — CID 106081746
5-(methylaminomethyl)-N-(6-oxo-1H-pyridazin-3-yl)thiophene-3-sulfonamide (PubChem CID 106081746) has the molecular formula C10H12N4O3S2 and a molecular weight of 300.37 g/mol. Its IUPAC name is 5-(methylaminomethyl)-N-(6-oxo-1H-pyridazin-3-yl)thiophene-3-sulfonamide.
| Compound Name | 5-(methylaminomethyl)-N-(6-oxo-1H-pyridazin-3-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106081746 |
| Molecular Formula | C10H12N4O3S2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 5-(methylaminomethyl)-N-(6-oxo-1H-pyridazin-3-yl)thiophene-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)Nc2ccc(=O)[nH]n2)cs1 |
| InChI | InChI=1S/C10H12N4O3S2/c1-11-5-7-4-8(6-18-7)19(16,17)14-9-2-3-10(15)13-12-9/h2-4,6,11H,5H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | AGSCQVYWACDKHA-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |