C12H11F3N2O2S2 — CID 106056250
5-(methylaminomethyl)-N-(2,3,5-trifluorophenyl)thiophene-3-sulfonamide (PubChem CID 106056250) has the molecular formula C12H11F3N2O2S2 and a molecular weight of 336.36 g/mol. Its IUPAC name is 5-(methylaminomethyl)-N-(2,3,5-trifluorophenyl)thiophene-3-sulfonamide.
| Compound Name | 5-(methylaminomethyl)-N-(2,3,5-trifluorophenyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106056250 |
| Molecular Formula | C12H11F3N2O2S2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 5-(methylaminomethyl)-N-(2,3,5-trifluorophenyl)thiophene-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)Nc2cc(F)cc(F)c2F)cs1 |
| InChI | InChI=1S/C12H11F3N2O2S2/c1-16-5-8-4-9(6-20-8)21(18,19)17-11-3-7(13)2-10(14)12(11)15/h2-4,6,16-17H,5H2,1H3 |
| InChIKey | CPMOSDYQSWZLJL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|