C11H10F3N3O2S — CID 106056264
5-(aminomethyl)-N-(2,3,5-trifluorophenyl)-1H-pyrrole-3-sulfonamide (PubChem CID 106056264) has the molecular formula C11H10F3N3O2S and a molecular weight of 305.28 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2,3,5-trifluorophenyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(2,3,5-trifluorophenyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106056264 |
| Molecular Formula | C11H10F3N3O2S |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 5-(aminomethyl)-N-(2,3,5-trifluorophenyl)-1H-pyrrole-3-sulfonamide |
| SMILES | NCc1cc(S(=O)(=O)Nc2cc(F)cc(F)c2F)c[nH]1 |
| InChI | InChI=1S/C11H10F3N3O2S/c12-6-1-9(13)11(14)10(2-6)17-20(18,19)8-3-7(4-15)16-5-8/h1-3,5,16-17H,4,15H2 |
| InChIKey | GPIPTOJLYXFGFA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|