C9H13N5O2S — CID 114137503
5-(aminomethyl)-N-(1H-pyrazol-4-ylmethyl)-1H-pyrrole-3-sulfonamide (PubChem CID 114137503) has the molecular formula C9H13N5O2S and a molecular weight of 255.30 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(1H-pyrazol-4-ylmethyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(1H-pyrazol-4-ylmethyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 114137503 |
| Molecular Formula | C9H13N5O2S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 5-(aminomethyl)-N-(1H-pyrazol-4-ylmethyl)-1H-pyrrole-3-sulfonamide |
| SMILES | NCc1cc(S(=O)(=O)NCc2cn[nH]c2)c[nH]1 |
| InChI | InChI=1S/C9H13N5O2S/c10-2-8-1-9(6-11-8)17(15,16)14-5-7-3-12-13-4-7/h1,3-4,6,11,14H,2,5,10H2,(H,12,13) |
| InChIKey | APVANJBBQNOVAM-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |