C10H15N5O2S — CID 106076457
5-(aminomethyl)-N-[(1-methylpyrazol-3-yl)methyl]-1H-pyrrole-3-sulfonamide (PubChem CID 106076457) has the molecular formula C10H15N5O2S and a molecular weight of 269.33 g/mol. Its IUPAC name is 5-(aminomethyl)-N-[(1-methylpyrazol-3-yl)methyl]-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-[(1-methylpyrazol-3-yl)methyl]-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106076457 |
| Molecular Formula | C10H15N5O2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 5-(aminomethyl)-N-[(1-methylpyrazol-3-yl)methyl]-1H-pyrrole-3-sulfonamide |
| SMILES | Cn1ccc(CNS(=O)(=O)c2c[nH]c(CN)c2)n1 |
| InChI | InChI=1S/C10H15N5O2S/c1-15-3-2-8(14-15)6-13-18(16,17)10-4-9(5-11)12-7-10/h2-4,7,12-13H,5-6,11H2,1H3 |
| InChIKey | HICGWCSAGFWKEH-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |