C12H12N4O2S — CID 82872695
3-cyano-N-[(1-methylpyrazol-3-yl)methyl]benzenesulfonamide (PubChem CID 82872695) has the molecular formula C12H12N4O2S and a molecular weight of 276.32 g/mol. Its IUPAC name is 3-cyano-N-[(1-methylpyrazol-3-yl)methyl]benzenesulfonamide.
| Compound Name | 3-cyano-N-[(1-methylpyrazol-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 82872695 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 3-cyano-N-[(1-methylpyrazol-3-yl)methyl]benzenesulfonamide |
| SMILES | Cn1ccc(CNS(=O)(=O)c2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C12H12N4O2S/c1-16-6-5-11(15-16)9-14-19(17,18)12-4-2-3-10(7-12)8-13/h2-7,14H,9H2,1H3 |
| InChIKey | WKDGJHUHNVBVAP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |