C14H9F3N2O2S — CID 3292896
3-cyano-N-[(3,4,5-trifluorophenyl)methyl]benzenesulfonamide (PubChem CID 3292896) has the molecular formula C14H9F3N2O2S and a molecular weight of 326.30 g/mol. Its IUPAC name is 3-cyano-N-[(3,4,5-trifluorophenyl)methyl]benzenesulfonamide.
| Compound Name | 3-cyano-N-[(3,4,5-trifluorophenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3292896 |
| Molecular Formula | C14H9F3N2O2S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 3-cyano-N-[(3,4,5-trifluorophenyl)methyl]benzenesulfonamide |
| SMILES | N#Cc1cccc(S(=O)(=O)NCc2cc(F)c(F)c(F)c2)c1 |
| InChI | InChI=1S/C14H9F3N2O2S/c15-12-5-10(6-13(16)14(12)17)8-19-22(20,21)11-3-1-2-9(4-11)7-18/h1-6,19H,8H2 |
| InChIKey | CPSZBYKUGCMRMT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|