C12H19N5O2S — CID 106077320
5-(aminomethyl)-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1H-pyrrole-3-sulfonamide (PubChem CID 106077320) has the molecular formula C12H19N5O2S and a molecular weight of 297.38 g/mol. Its IUPAC name is 5-(aminomethyl)-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106077320 |
| Molecular Formula | C12H19N5O2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 5-(aminomethyl)-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1H-pyrrole-3-sulfonamide |
| SMILES | CCc1nn(C)cc1CNS(=O)(=O)c1c[nH]c(CN)c1 |
| InChI | InChI=1S/C12H19N5O2S/c1-3-12-9(8-17(2)16-12)6-15-20(18,19)11-4-10(5-13)14-7-11/h4,7-8,14-15H,3,5-6,13H2,1-2H3 |
| InChIKey | CUANNMRJTCGLRO-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |