C12H14ClN3O2S — CID 106058647
5-(aminomethyl)-N-[(2-chlorophenyl)methyl]-1H-pyrrole-3-sulfonamide (PubChem CID 106058647) has the molecular formula C12H14ClN3O2S and a molecular weight of 299.78 g/mol. Its IUPAC name is 5-(aminomethyl)-N-[(2-chlorophenyl)methyl]-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-[(2-chlorophenyl)methyl]-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106058647 |
| Molecular Formula | C12H14ClN3O2S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 5-(aminomethyl)-N-[(2-chlorophenyl)methyl]-1H-pyrrole-3-sulfonamide |
| SMILES | NCc1cc(S(=O)(=O)NCc2ccccc2Cl)c[nH]1 |
| InChI | InChI=1S/C12H14ClN3O2S/c13-12-4-2-1-3-9(12)7-16-19(17,18)11-5-10(6-14)15-8-11/h1-5,8,15-16H,6-7,14H2 |
| InChIKey | LWHLQOWAXYCNQS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |