C12H11ClN2O3S — CID 43629113
N-[(2-chlorophenyl)methyl]-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 43629113) has the molecular formula C12H11ClN2O3S and a molecular weight of 298.75 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 43629113 |
| Molecular Formula | C12H11ClN2O3S |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | O=c1ccc(S(=O)(=O)NCc2ccccc2Cl)c[nH]1 |
| InChI | InChI=1S/C12H11ClN2O3S/c13-11-4-2-1-3-9(11)7-15-19(17,18)10-5-6-12(16)14-8-10/h1-6,8,15H,7H2,(H,14,16) |
| InChIKey | VLPZBZFKGBUZGD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |