C10H15N5O2S — CID 112550104
N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1H-imidazole-5-sulfonamide (PubChem CID 112550104) has the molecular formula C10H15N5O2S and a molecular weight of 269.33 g/mol. Its IUPAC name is N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1H-imidazole-5-sulfonamide.
| Compound Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 112550104 |
| Molecular Formula | C10H15N5O2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1H-imidazole-5-sulfonamide |
| SMILES | CCc1nn(C)cc1CNS(=O)(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C10H15N5O2S/c1-3-9-8(6-15(2)14-9)4-13-18(16,17)10-5-11-7-12-10/h5-7,13H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | ALJIGGSBFMXBPJ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |