C13H15N5O2S — CID 106546673
2-cyano-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]pyridine-3-sulfonamide (PubChem CID 106546673) has the molecular formula C13H15N5O2S and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-cyano-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]pyridine-3-sulfonamide.
| Compound Name | 2-cyano-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106546673 |
| Molecular Formula | C13H15N5O2S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-cyano-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]pyridine-3-sulfonamide |
| SMILES | CCc1nn(C)cc1CNS(=O)(=O)c1cccnc1C#N |
| InChI | InChI=1S/C13H15N5O2S/c1-3-11-10(9-18(2)17-11)8-16-21(19,20)13-5-4-6-15-12(13)7-14/h4-6,9,16H,3,8H2,1-2H3 |
| InChIKey | UHTCFEDNLJYKBI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |