C11H9N3O3S — CID 106545740
2-cyano-N-(furan-3-ylmethyl)pyridine-3-sulfonamide (PubChem CID 106545740) has the molecular formula C11H9N3O3S and a molecular weight of 263.28 g/mol. Its IUPAC name is 2-cyano-N-(furan-3-ylmethyl)pyridine-3-sulfonamide.
| Compound Name | 2-cyano-N-(furan-3-ylmethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106545740 |
| Molecular Formula | C11H9N3O3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 2-cyano-N-(furan-3-ylmethyl)pyridine-3-sulfonamide |
| SMILES | N#Cc1ncccc1S(=O)(=O)NCc1ccoc1 |
| InChI | InChI=1S/C11H9N3O3S/c12-6-10-11(2-1-4-13-10)18(15,16)14-7-9-3-5-17-8-9/h1-5,8,14H,7H2 |
| InChIKey | AGEKWNVHQMELDD-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |