C13H13F3N2O3S — CID 75476531
N-ethyl-N-(furan-3-ylmethyl)-6-(trifluoromethyl)pyridine-3-sulfonamide (PubChem CID 75476531) has the molecular formula C13H13F3N2O3S and a molecular weight of 334.32 g/mol. Its IUPAC name is N-ethyl-N-(furan-3-ylmethyl)-6-(trifluoromethyl)pyridine-3-sulfonamide.
| Compound Name | N-ethyl-N-(furan-3-ylmethyl)-6-(trifluoromethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 75476531 |
| Molecular Formula | C13H13F3N2O3S |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | N-ethyl-N-(furan-3-ylmethyl)-6-(trifluoromethyl)pyridine-3-sulfonamide |
| SMILES | CCN(Cc1ccoc1)S(=O)(=O)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C13H13F3N2O3S/c1-2-18(8-10-5-6-21-9-10)22(19,20)11-3-4-12(17-7-11)13(14,15)16/h3-7,9H,2,8H2,1H3 |
| InChIKey | DDGGUHCRJXIHSC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |