C14H16N2O6S — CID 90582794
N-(furan-3-ylmethyl)-N-(2-methoxyethyl)-3-nitrobenzenesulfonamide (PubChem CID 90582794) has the molecular formula C14H16N2O6S and a molecular weight of 340.36 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-N-(2-methoxyethyl)-3-nitrobenzenesulfonamide.
| Compound Name | N-(furan-3-ylmethyl)-N-(2-methoxyethyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 90582794 |
| Molecular Formula | C14H16N2O6S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | N-(furan-3-ylmethyl)-N-(2-methoxyethyl)-3-nitrobenzenesulfonamide |
| SMILES | COCCN(Cc1ccoc1)S(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H16N2O6S/c1-21-8-6-15(10-12-5-7-22-11-12)23(19,20)14-4-2-3-13(9-14)16(17)18/h2-5,7,9,11H,6,8,10H2,1H3 |
| InChIKey | QMSWWKQMVZENRV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 102.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|