C15H18N2O5S2 — CID 39952752
N-(2-methoxyethyl)-4-methyl-3-nitro-N-(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 39952752) has the molecular formula C15H18N2O5S2 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-methyl-3-nitro-N-(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | N-(2-methoxyethyl)-4-methyl-3-nitro-N-(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 39952752 |
| Molecular Formula | C15H18N2O5S2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | N-(2-methoxyethyl)-4-methyl-3-nitro-N-(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | COCCN(Cc1cccs1)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H18N2O5S2/c1-12-5-6-14(10-15(12)17(18)19)24(20,21)16(7-8-22-2)11-13-4-3-9-23-13/h3-6,9-10H,7-8,11H2,1-2H3 |
| InChIKey | AFYKUPJUDQJDCM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|