C16H21N3O4S2 — CID 9113790
N,N-diethyl-4-[methyl(thiophen-2-ylmethyl)amino]-3-nitrobenzenesulfonamide (PubChem CID 9113790) has the molecular formula C16H21N3O4S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is N,N-diethyl-4-[methyl(thiophen-2-ylmethyl)amino]-3-nitrobenzenesulfonamide.
| Compound Name | N,N-diethyl-4-[methyl(thiophen-2-ylmethyl)amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 9113790 |
| Molecular Formula | C16H21N3O4S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N,N-diethyl-4-[methyl(thiophen-2-ylmethyl)amino]-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N(C)Cc2cccs2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H21N3O4S2/c1-4-18(5-2)25(22,23)14-8-9-15(16(11-14)19(20)21)17(3)12-13-7-6-10-24-13/h6-11H,4-5,12H2,1-3H3 |
| InChIKey | XBFSOPOSMHLVEF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|