C13H16N2O4S3 — CID 26530442
4-N-ethyl-4-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide (PubChem CID 26530442) has the molecular formula C13H16N2O4S3 and a molecular weight of 360.48 g/mol. Its IUPAC name is 4-N-ethyl-4-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide.
| Compound Name | 4-N-ethyl-4-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 26530442 |
| Molecular Formula | C13H16N2O4S3 |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 4-N-ethyl-4-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide |
| SMILES | CCN(Cc1cccs1)S(=O)(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H16N2O4S3/c1-2-15(10-11-4-3-9-20-11)22(18,19)13-7-5-12(6-8-13)21(14,16)17/h3-9H,2,10H2,1H3,(H2,14,16,17) |
| InChIKey | FXUXXTBXLNDQCL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |