C18H19NO3S3 — CID 8801727
4-ethoxy-N,N-bis(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 8801727) has the molecular formula C18H19NO3S3 and a molecular weight of 393.56 g/mol. Its IUPAC name is 4-ethoxy-N,N-bis(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-ethoxy-N,N-bis(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 8801727 |
| Molecular Formula | C18H19NO3S3 |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 4-ethoxy-N,N-bis(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(Cc2cccs2)Cc2cccs2)cc1 |
| InChI | InChI=1S/C18H19NO3S3/c1-2-22-15-7-9-18(10-8-15)25(20,21)19(13-16-5-3-11-23-16)14-17-6-4-12-24-17/h3-12H,2,13-14H2,1H3 |
| InChIKey | ATNSMCBIWRBTKI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |