C16H18FNO4S2 — CID 3241642
ethyl 3-[(4-fluorophenyl)sulfonyl-(thiophen-2-ylmethyl)amino]propanoate (PubChem CID 3241642) has the molecular formula C16H18FNO4S2 and a molecular weight of 371.46 g/mol. Its IUPAC name is ethyl 3-[(4-fluorophenyl)sulfonyl-(thiophen-2-ylmethyl)amino]propanoate.
| Compound Name | ethyl 3-[(4-fluorophenyl)sulfonyl-(thiophen-2-ylmethyl)amino]propanoate |
|---|---|
| PubChem CID | 3241642 |
| Molecular Formula | C16H18FNO4S2 |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | ethyl 3-[(4-fluorophenyl)sulfonyl-(thiophen-2-ylmethyl)amino]propanoate |
| SMILES | CCOC(=O)CCN(Cc1cccs1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H18FNO4S2/c1-2-22-16(19)9-10-18(12-14-4-3-11-23-14)24(20,21)15-7-5-13(17)6-8-15/h3-8,11H,2,9-10,12H2,1H3 |
| InChIKey | RIFRIEOIRXOTJV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |