C13H17N3O2S2 — CID 61437971
N-ethyl-2-hydrazinyl-N-(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 61437971) has the molecular formula C13H17N3O2S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is N-ethyl-2-hydrazinyl-N-(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | N-ethyl-2-hydrazinyl-N-(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61437971 |
| Molecular Formula | C13H17N3O2S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | N-ethyl-2-hydrazinyl-N-(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | CCN(Cc1cccs1)S(=O)(=O)c1ccccc1NN |
| InChI | InChI=1S/C13H17N3O2S2/c1-2-16(10-11-6-5-9-19-11)20(17,18)13-8-4-3-7-12(13)15-14/h3-9,15H,2,10,14H2,1H3 |
| InChIKey | AYHQDVDIJWLEQZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|