C17H14N2O2S3 — CID 8801780
2-cyano-N,N-bis(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 8801780) has the molecular formula C17H14N2O2S3 and a molecular weight of 374.51 g/mol. Its IUPAC name is 2-cyano-N,N-bis(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | 2-cyano-N,N-bis(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 8801780 |
| Molecular Formula | C17H14N2O2S3 |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 2-cyano-N,N-bis(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | N#Cc1ccccc1S(=O)(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C17H14N2O2S3/c18-11-14-5-1-2-8-17(14)24(20,21)19(12-15-6-3-9-22-15)13-16-7-4-10-23-16/h1-10H,12-13H2 |
| InChIKey | RBKZNPFINYYNAF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |