C18H20N2O4S — CID 8801338
2-cyano-N-[(3,4-dimethoxyphenyl)methyl]-N-ethylbenzenesulfonamide (PubChem CID 8801338) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-cyano-N-[(3,4-dimethoxyphenyl)methyl]-N-ethylbenzenesulfonamide.
| Compound Name | 2-cyano-N-[(3,4-dimethoxyphenyl)methyl]-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 8801338 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-cyano-N-[(3,4-dimethoxyphenyl)methyl]-N-ethylbenzenesulfonamide |
| SMILES | CCN(Cc1ccc(OC)c(OC)c1)S(=O)(=O)c1ccccc1C#N |
| InChI | InChI=1S/C18H20N2O4S/c1-4-20(13-14-9-10-16(23-2)17(11-14)24-3)25(21,22)18-8-6-5-7-15(18)12-19/h5-11H,4,13H2,1-3H3 |
| InChIKey | USEGHGPBSKOLHX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |