C17H18N2O2 — CID 78913551
2-[(3,4-dimethoxyphenyl)methyl-methylamino]benzonitrile (PubChem CID 78913551) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl-methylamino]benzonitrile.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl-methylamino]benzonitrile |
|---|---|
| PubChem CID | 78913551 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl-methylamino]benzonitrile |
| SMILES | COc1ccc(CN(C)c2ccccc2C#N)cc1OC |
| InChI | InChI=1S/C17H18N2O2/c1-19(15-7-5-4-6-14(15)11-18)12-13-8-9-16(20-2)17(10-13)21-3/h4-10H,12H2,1-3H3 |
| InChIKey | YHPZTAMCGPEEIX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |