C18H20N2O — CID 65343788
2-methoxy-5-[(N,2,4-trimethylanilino)methyl]benzonitrile (PubChem CID 65343788) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-methoxy-5-[(N,2,4-trimethylanilino)methyl]benzonitrile.
| Compound Name | 2-methoxy-5-[(N,2,4-trimethylanilino)methyl]benzonitrile |
|---|---|
| PubChem CID | 65343788 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-methoxy-5-[(N,2,4-trimethylanilino)methyl]benzonitrile |
| SMILES | COc1ccc(CN(C)c2ccc(C)cc2C)cc1C#N |
| InChI | InChI=1S/C18H20N2O/c1-13-5-7-17(14(2)9-13)20(3)12-15-6-8-18(21-4)16(10-15)11-19/h5-10H,12H2,1-4H3 |
| InChIKey | ADAALVQAPWNLCM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |