C17H18N2 — CID 63511662
4-methyl-2-(N,2,4-trimethylanilino)benzonitrile (PubChem CID 63511662) has the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 4-methyl-2-(N,2,4-trimethylanilino)benzonitrile.
| Compound Name | 4-methyl-2-(N,2,4-trimethylanilino)benzonitrile |
|---|---|
| PubChem CID | 63511662 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 4-methyl-2-(N,2,4-trimethylanilino)benzonitrile |
| SMILES | Cc1ccc(N(C)c2cc(C)ccc2C#N)c(C)c1 |
| InChI | InChI=1S/C17H18N2/c1-12-6-8-16(14(3)9-12)19(4)17-10-13(2)5-7-15(17)11-18/h5-10H,1-4H3 |
| InChIKey | OZNSNKVTPOHLGT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |