C16H15ClN2 — CID 63511821
3-chloro-4-(N,2,4-trimethylanilino)benzonitrile (PubChem CID 63511821) has the molecular formula C16H15ClN2 and a molecular weight of 270.76 g/mol. Its IUPAC name is 3-chloro-4-(N,2,4-trimethylanilino)benzonitrile.
| Compound Name | 3-chloro-4-(N,2,4-trimethylanilino)benzonitrile |
|---|---|
| PubChem CID | 63511821 |
| Molecular Formula | C16H15ClN2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 3-chloro-4-(N,2,4-trimethylanilino)benzonitrile |
| SMILES | Cc1ccc(N(C)c2ccc(C#N)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C16H15ClN2/c1-11-4-6-15(12(2)8-11)19(3)16-7-5-13(10-18)9-14(16)17/h4-9H,1-3H3 |
| InChIKey | OCGSFEHKYGIBGQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |