C16H17N3O — CID 115127414
3-amino-4-(2-methoxy-N,5-dimethylanilino)benzonitrile (PubChem CID 115127414) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 3-amino-4-(2-methoxy-N,5-dimethylanilino)benzonitrile.
| Compound Name | 3-amino-4-(2-methoxy-N,5-dimethylanilino)benzonitrile |
|---|---|
| PubChem CID | 115127414 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 3-amino-4-(2-methoxy-N,5-dimethylanilino)benzonitrile |
| SMILES | COc1ccc(C)cc1N(C)c1ccc(C#N)cc1N |
| InChI | InChI=1S/C16H17N3O/c1-11-4-7-16(20-3)15(8-11)19(2)14-6-5-12(10-17)9-13(14)18/h4-9H,18H2,1-3H3 |
| InChIKey | UCXJBDPCLIWLLA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|