C18H16ClNO2 — CID 18225853
(2-chloro-4-cyanophenyl) 3-(2,4-dimethylphenyl)propanoate (PubChem CID 18225853) has the molecular formula C18H16ClNO2 and a molecular weight of 313.78 g/mol. Its IUPAC name is (2-chloro-4-cyanophenyl) 3-(2,4-dimethylphenyl)propanoate.
| Compound Name | (2-chloro-4-cyanophenyl) 3-(2,4-dimethylphenyl)propanoate |
|---|---|
| PubChem CID | 18225853 |
| Molecular Formula | C18H16ClNO2 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (2-chloro-4-cyanophenyl) 3-(2,4-dimethylphenyl)propanoate |
| SMILES | Cc1ccc(CCC(=O)Oc2ccc(C#N)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C18H16ClNO2/c1-12-3-5-15(13(2)9-12)6-8-18(21)22-17-7-4-14(11-20)10-16(17)19/h3-5,7,9-10H,6,8H2,1-2H3 |
| InChIKey | FGGDCWSEOMASPX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|