C17H17ClN2 — CID 102665445
3-chloro-4-[(N,2,4-trimethylanilino)methyl]benzonitrile (PubChem CID 102665445) has the molecular formula C17H17ClN2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 3-chloro-4-[(N,2,4-trimethylanilino)methyl]benzonitrile.
| Compound Name | 3-chloro-4-[(N,2,4-trimethylanilino)methyl]benzonitrile |
|---|---|
| PubChem CID | 102665445 |
| Molecular Formula | C17H17ClN2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 3-chloro-4-[(N,2,4-trimethylanilino)methyl]benzonitrile |
| SMILES | Cc1ccc(N(C)Cc2ccc(C#N)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C17H17ClN2/c1-12-4-7-17(13(2)8-12)20(3)11-15-6-5-14(10-19)9-16(15)18/h4-9H,11H2,1-3H3 |
| InChIKey | WIOQYHZJACKEPD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |