About 2-(2-cyano-N,5-dimethylanilino)acetic acid
2-(2-cyano-N,5-dimethylanilino)acetic acid (PubChem CID 62308954) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-(2-cyano-N,5-dimethylanilino)acetic acid.
Molecular Properties
| Compound Name | 2-(2-cyano-N,5-dimethylanilino)acetic acid |
| PubChem CID | 62308954 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-(2-cyano-N,5-dimethylanilino)acetic acid |
| SMILES | Cc1ccc(C#N)c(N(C)CC(=O)O)c1 |
| InChI | InChI=1S/C11H12N2O2/c1-8-3-4-9(6-12)10(5-8)13(2)7-11(14)15/h3-5H,7H2,1-2H3,(H,14,15) |
| InChIKey | PRUYWQBHXUETFF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-cyano-N,5-dimethylanilino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyano-N,5-dimethylanilino)acetic acid?
The IUPAC name of 2-(2-cyano-N,5-dimethylanilino)acetic acid (CID 62308954) is 2-(2-cyano-N,5-dimethylanilino)acetic acid.
What is the SMILES notation for 2-(2-cyano-N,5-dimethylanilino)acetic acid?
The canonical SMILES for 2-(2-cyano-N,5-dimethylanilino)acetic acid is Cc1ccc(C#N)c(N(C)CC(=O)O)c1.
What is the InChIKey of 2-(2-cyano-N,5-dimethylanilino)acetic acid?
The InChIKey is PRUYWQBHXUETFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2/c1-8-3-4-9(6-12)10(5-8)13(2)7-11(14)15/h3-5H,7H2,1-2H3,(H,14,15).
What are the key properties of 2-(2-cyano-N,5-dimethylanilino)acetic acid?
2-(2-cyano-N,5-dimethylanilino)acetic acid has a molecular weight of 204.23 g/mol, XLogP of 1.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyano-N,5-dimethylanilino)acetic acid is sourced from PubChem (CID 62308954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).