C17H20BrNO — CID 63458833
N-[(5-bromo-2-methoxyphenyl)methyl]-N,2,4-trimethylaniline (PubChem CID 63458833) has the molecular formula C17H20BrNO and a molecular weight of 334.26 g/mol. Its IUPAC name is N-[(5-bromo-2-methoxyphenyl)methyl]-N,2,4-trimethylaniline.
| Compound Name | N-[(5-bromo-2-methoxyphenyl)methyl]-N,2,4-trimethylaniline |
|---|---|
| PubChem CID | 63458833 |
| Molecular Formula | C17H20BrNO |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N-[(5-bromo-2-methoxyphenyl)methyl]-N,2,4-trimethylaniline |
| SMILES | COc1ccc(Br)cc1CN(C)c1ccc(C)cc1C |
| InChI | InChI=1S/C17H20BrNO/c1-12-5-7-16(13(2)9-12)19(3)11-14-10-15(18)6-8-17(14)20-4/h5-10H,11H2,1-4H3 |
| InChIKey | VLJLIHPGFCIKTN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |